C28H37N2NaO6S2 — CID 163538804
sodium 4-[3,3,5-trimethyl-2-[(E)-2-[4-[propyl(2-sulfonatoethyl)amino]phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 163538804) has the molecular formula C28H37N2NaO6S2 and a molecular weight of 584.74 g/mol. Its IUPAC name is sodium 4-[3,3,5-trimethyl-2-[(E)-2-[4-[propyl(2-sulfonatoethyl)amino]phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | sodium 4-[3,3,5-trimethyl-2-[(E)-2-[4-[propyl(2-sulfonatoethyl)amino]phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 163538804 |
| Molecular Formula | C28H37N2NaO6S2 |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | sodium 4-[3,3,5-trimethyl-2-[(E)-2-[4-[propyl(2-sulfonatoethyl)amino]phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CCCN(CCS(=O)(=O)[O-])c1ccc(/C=C/C2=[N+](CCCCS(=O)(=O)[O-])c3ccc(C)cc3C2(C)C)cc1.[Na+] |
| InChI | InChI=1S/C28H38N2O6S2.Na/c1-5-16-29(18-20-38(34,35)36)24-12-9-23(10-13-24)11-15-27-28(3,4)25-21-22(2)8-14-26(25)30(27)17-6-7-19-37(31,32)33;/h8-15,21H,5-7,16-20H2,1-4H3,(H-,31,32,33,34,35,36);/q;+1/p-1 |
| InChIKey | VCWTVVGAOPNFHT-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|