C24H28N2NaO6S+ — CID 59595263
sodium 3-[5-carboxy-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonoperoxoate (PubChem CID 59595263) has the molecular formula C24H28N2NaO6S+ and a molecular weight of 495.55 g/mol. Its IUPAC name is sodium 3-[5-carboxy-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonoperoxoate.
| Compound Name | sodium 3-[5-carboxy-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonoperoxoate |
|---|---|
| PubChem CID | 59595263 |
| Molecular Formula | C24H28N2NaO6S+ |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | sodium 3-[5-carboxy-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonoperoxoate |
| SMILES | CN(C)c1ccc(/C=C/C2=[N+](CCCS(=O)(=O)O[O-])c3ccc(C(=O)O)cc3C2(C)C)cc1.[Na+] |
| InChI | InChI=1S/C24H28N2O6S.Na/c1-24(2)20-16-18(23(27)28)9-12-21(20)26(14-5-15-33(30,31)32-29)22(24)13-8-17-6-10-19(11-7-17)25(3)4;/h6-13,16H,5,14-15H2,1-4H3,(H-,27,28,29);/q;+1 |
| InChIKey | ZIMUMDLTPWJCRW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|