C21H24N3O2+ — CID 6235558
N,N-dimethyl-4-[(E)-2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]aniline (PubChem CID 6235558) has the molecular formula C21H24N3O2+ and a molecular weight of 350.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 6235558 |
| Molecular Formula | C21H24N3O2+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/C2=[N+](C)c3ccc([N+](=O)[O-])cc3C2(C)C)cc1 |
| InChI | InChI=1S/C21H24N3O2/c1-21(2)18-14-17(24(25)26)11-12-19(18)23(5)20(21)13-8-15-6-9-16(10-7-15)22(3)4/h6-14H,1-5H3/q+1 |
| InChIKey | YFUSKOPMEDDRGQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|