C21H26N3O2SY+ — CID 160572178
N,N-diethyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine;yttrium (PubChem CID 160572178) has the molecular formula C21H26N3O2SY+ and a molecular weight of 473.43 g/mol. Its IUPAC name is N,N-diethyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine;yttrium.
| Compound Name | N,N-diethyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine;yttrium |
|---|---|
| PubChem CID | 160572178 |
| Molecular Formula | C21H26N3O2SY+ |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N,N-diethyl-5-[2-(1,3,3-trimethyl-5-nitroindol-1-ium-2-yl)ethenyl]thiophen-2-amine;yttrium |
| SMILES | CCN(CC)c1ccc(C=CC2=[N+](C)c3ccc([N+](=O)[O-])cc3C2(C)C)s1.[Y] |
| InChI | InChI=1S/C21H26N3O2S.Y/c1-6-23(7-2)20-13-10-16(27-20)9-12-19-21(3,4)17-14-15(24(25)26)8-11-18(17)22(19)5;/h8-14H,6-7H2,1-5H3;/q+1; |
| InChIKey | BPJWUGFKBFKNPV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|