C23H28Cl2N2O4 — CID 158850422
4-[2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethylaniline perchlorate (PubChem CID 158850422) has the molecular formula C23H28Cl2N2O4 and a molecular weight of 467.39 g/mol. Its IUPAC name is 4-[2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethylaniline perchlorate.
| Compound Name | 4-[2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethylaniline perchlorate |
|---|---|
| PubChem CID | 158850422 |
| Molecular Formula | C23H28Cl2N2O4 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4-[2-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-N,N-diethylaniline perchlorate |
| SMILES | CCN(CC)c1ccc(C=CC2=[N+](C)c3ccc(Cl)cc3C2(C)C)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H28ClN2.ClHO4/c1-6-26(7-2)19-12-8-17(9-13-19)10-15-22-23(3,4)20-16-18(24)11-14-21(20)25(22)5;2-1(3,4)5/h8-16H,6-7H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IZJMHYJSNNAGHY-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|