C33H35N2O6S2- — CID 170853702
N,N-diethyl-4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;naphthalene-1,5-disulfonate (PubChem CID 170853702) has the molecular formula C33H35N2O6S2- and a molecular weight of 619.79 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;naphthalene-1,5-disulfonate.
| Compound Name | N,N-diethyl-4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;naphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 170853702 |
| Molecular Formula | C33H35N2O6S2- |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | N,N-diethyl-4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;naphthalene-1,5-disulfonate |
| SMILES | CCN(CC)c1ccc(C=CC2=[N+](C)c3ccccc3C2(C)C)cc1.O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])cccc12 |
| InChI | InChI=1S/C23H29N2.C10H8O6S2/c1-6-25(7-2)19-15-12-18(13-16-19)14-17-22-23(3,4)20-10-8-9-11-21(20)24(22)5;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h8-17H,6-7H2,1-5H3;1-6H,(H,11,12,13)(H,14,15,16)/q+1;/p-2 |
| InChIKey | BHLHYKPKHXVCKC-UHFFFAOYSA-L |
| XLogP | 5.90 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|