C36H40N4O8S2 — CID 42631329
1-N,5-N-bis[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]naphthalene-1,5-diamine;hydrogen sulfate (PubChem CID 42631329) has the molecular formula C36H40N4O8S2 and a molecular weight of 720.87 g/mol. Its IUPAC name is 1-N,5-N-bis[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]naphthalene-1,5-diamine;hydrogen sulfate.
| Compound Name | 1-N,5-N-bis[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]naphthalene-1,5-diamine;hydrogen sulfate |
|---|---|
| PubChem CID | 42631329 |
| Molecular Formula | C36H40N4O8S2 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 1-N,5-N-bis[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]naphthalene-1,5-diamine;hydrogen sulfate |
| SMILES | C[N+]1=C(/C=C/Nc2cccc3c(N/C=C/C4=[N+](C)c5ccccc5C4(C)C)cccc23)C(C)(C)c2ccccc21.O=S(=O)([O-])O.O=S(=O)([O-])O |
| InChI | InChI=1S/C36H36N4.2H2O4S/c1-35(2)27-15-7-9-19-31(27)39(5)33(35)21-23-37-29-17-11-14-26-25(29)13-12-18-30(26)38-24-22-34-36(3,4)28-16-8-10-20-32(28)40(34)6;2*1-5(2,3)4/h7-24H,1-6H3;2*(H2,1,2,3,4) |
| InChIKey | NPFPRRGRIASQON-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|