C42H50N4O8S — CID 6451709
bis(2,4-dimethoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline);sulfate (PubChem CID 6451709) has the molecular formula C42H50N4O8S and a molecular weight of 770.95 g/mol. Its IUPAC name is bis(2,4-dimethoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline);sulfate.
| Compound Name | bis(2,4-dimethoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline);sulfate |
|---|---|
| PubChem CID | 6451709 |
| Molecular Formula | C42H50N4O8S |
| Molecular Weight | 770.95 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | bis(2,4-dimethoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline);sulfate |
| SMILES | COc1ccc(N/C=C/C2=[N+](C)c3ccccc3C2(C)C)c(OC)c1.COc1ccc(N/C=C/C2=[N+](C)c3ccccc3C2(C)C)c(OC)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C21H24N2O2.H2O4S/c2*1-21(2)16-8-6-7-9-18(16)23(3)20(21)12-13-22-17-11-10-15(24-4)14-19(17)25-5;1-5(2,3)4/h2*6-14H,1-5H3;(H2,1,2,3,4) |
| InChIKey | QUDUEWXQHQRQAZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|