C23H26INO4 — CID 146050921
methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate iodide (PubChem CID 146050921) has the molecular formula C23H26INO4 and a molecular weight of 507.37 g/mol. Its IUPAC name is methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate iodide.
| Compound Name | methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 146050921 |
| Molecular Formula | C23H26INO4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | methyl 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate iodide |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)C(/C=C/c1ccc(OC)c(OC)c1)=[N+]2C.[I-] |
| InChI | InChI=1S/C23H26NO4.HI/c1-23(2)17-14-16(22(25)28-6)9-10-18(17)24(3)21(23)12-8-15-7-11-19(26-4)20(13-15)27-5;/h7-14H,1-6H3;1H/q+1;/p-1/b12-8+; |
| InChIKey | HYYNNXJNIUVIGX-MXZHIVQLSA-M |
| XLogP | 1.21 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|