C30H28ClN2O2+ — CID 53424055
methyl 2-[2-[2-(4-chlorophenyl)-1-methylindol-3-yl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate (PubChem CID 53424055) has the molecular formula C30H28ClN2O2+ and a molecular weight of 484.02 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-chlorophenyl)-1-methylindol-3-yl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate.
| Compound Name | methyl 2-[2-[2-(4-chlorophenyl)-1-methylindol-3-yl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 53424055 |
| Molecular Formula | C30H28ClN2O2+ |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | methyl 2-[2-[2-(4-chlorophenyl)-1-methylindol-3-yl]ethenyl]-1,3,3-trimethylindol-1-ium-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C)(C)C(C=Cc1c(-c3ccc(Cl)cc3)n(C)c3ccccc13)=[N+]2C |
| InChI | InChI=1S/C30H28ClN2O2/c1-30(2)24-18-20(29(34)35-5)12-16-26(24)32(3)27(30)17-15-23-22-8-6-7-9-25(22)33(4)28(23)19-10-13-21(31)14-11-19/h6-18H,1-5H3/q+1 |
| InChIKey | PVOYWULEPPZERL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|