C28H26ClN2+ — CID 71066943
5-chloro-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium (PubChem CID 71066943) has the molecular formula C28H26ClN2+ and a molecular weight of 425.98 g/mol. Its IUPAC name is 5-chloro-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium.
| Compound Name | 5-chloro-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium |
|---|---|
| PubChem CID | 71066943 |
| Molecular Formula | C28H26ClN2+ |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 5-chloro-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium |
| SMILES | Cn1c(-c2ccccc2)c(C=CC2=[N+](C)c3ccc(Cl)cc3C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C28H26ClN2/c1-28(2)23-18-20(29)14-16-25(23)30(3)26(28)17-15-22-21-12-8-9-13-24(21)31(4)27(22)19-10-6-5-7-11-19/h5-18H,1-4H3/q+1 |
| InChIKey | YQQZRPZYUPJVDV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|