C58H58N4O6S — CID 74935186
bis(5-methoxy-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium);sulfate (PubChem CID 74935186) has the molecular formula C58H58N4O6S and a molecular weight of 939.19 g/mol. Its IUPAC name is bis(5-methoxy-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium);sulfate.
| Compound Name | bis(5-methoxy-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium);sulfate |
|---|---|
| PubChem CID | 74935186 |
| Molecular Formula | C58H58N4O6S |
| Molecular Weight | 939.19 g/mol |
| Exact Mass | 938.41 |
| IUPAC Name | bis(5-methoxy-1,3,3-trimethyl-2-[2-(1-methyl-2-phenylindol-3-yl)ethenyl]indol-1-ium);sulfate |
| SMILES | COc1ccc2c(c1)C(C)(C)C(C=Cc1c(-c3ccccc3)n(C)c3ccccc13)=[N+]2C.COc1ccc2c(c1)C(C)(C)C(C=Cc1c(-c3ccccc3)n(C)c3ccccc13)=[N+]2C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C29H29N2O.H2O4S/c2*1-29(2)24-19-21(32-5)15-17-26(24)30(3)27(29)18-16-23-22-13-9-10-14-25(22)31(4)28(23)20-11-7-6-8-12-20;1-5(2,3)4/h2*6-19H,1-5H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | NIUGKBGUKZLVDF-UHFFFAOYSA-L |
| XLogP | 11.81 |
| TPSA | 114.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.19 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|