C32H28N2O2 — CID 72652250
(4E)-4-[(3-ethyl-1,3-dimethylindol-1-ium-2-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate (PubChem CID 72652250) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (4E)-4-[(3-ethyl-1,3-dimethylindol-1-ium-2-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-4-[(3-ethyl-1,3-dimethylindol-1-ium-2-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 72652250 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (4E)-4-[(3-ethyl-1,3-dimethylindol-1-ium-2-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate |
| SMILES | CCC1(C)C(/C=C2/C(=O)C(c3c(-c4ccccc4)n(C)c4ccccc34)=C2[O-])=[N+](C)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O2/c1-5-32(2)23-16-10-12-18-25(23)33(3)26(32)19-22-30(35)28(31(22)36)27-21-15-9-11-17-24(21)34(4)29(27)20-13-7-6-8-14-20/h6-19H,5H2,1-4H3 |
| InChIKey | FBHBMTRAZWYHLE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|