C35H32N2O2 — CID 140609794
(4Z)-4-[(1',5'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate (PubChem CID 140609794) has the molecular formula C35H32N2O2 and a molecular weight of 512.65 g/mol. Its IUPAC name is (4Z)-4-[(1',5'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[(1',5'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140609794 |
| Molecular Formula | C35H32N2O2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (4Z)-4-[(1',5'-dimethylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)methylidene]-2-(1-methyl-2-phenylindol-3-yl)-3-oxocyclobuten-1-olate |
| SMILES | Cc1ccc2c(c1)C1(CCCCC1)C(/C=C1\C(=O)C(c3c(-c4ccccc4)n(C)c4ccccc34)=C1[O-])=[N+]2C |
| InChI | InChI=1S/C35H32N2O2/c1-22-16-17-28-26(20-22)35(18-10-5-11-19-35)29(36(28)2)21-25-33(38)31(34(25)39)30-24-14-8-9-15-27(24)37(3)32(30)23-12-6-4-7-13-23/h4,6-9,12-17,20-21H,5,10-11,18-19H2,1-3H3 |
| InChIKey | OEYUDXPTWYLWLM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|