C32H29N2O2+ — CID 72652334
3-hydroxy-2-(1-methylindol-3-yl)-4-[(3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane]-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 72652334) has the molecular formula C32H29N2O2+ and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-hydroxy-2-(1-methylindol-3-yl)-4-[(3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane]-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | 3-hydroxy-2-(1-methylindol-3-yl)-4-[(3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane]-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 72652334 |
| Molecular Formula | C32H29N2O2+ |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 3-hydroxy-2-(1-methylindol-3-yl)-4-[(3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane]-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | Cn1cc(C2=C(O)C(=CC3=[N+](C)c4ccc5ccccc5c4C34CCCCC4)C2=O)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O2/c1-33-19-24(22-12-6-7-13-25(22)33)28-30(35)23(31(28)36)18-27-32(16-8-3-9-17-32)29-21-11-5-4-10-20(21)14-15-26(29)34(27)2/h4-7,10-15,18-19H,3,8-9,16-17H2,1-2H3/p+1 |
| InChIKey | QTSAPVAQSNGWRE-UHFFFAOYSA-O |
| XLogP | 6.74 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|