C29H25N2O2+ — CID 136618906
(4E)-3-hydroxy-2-(1-methylindol-3-yl)-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 136618906) has the molecular formula C29H25N2O2+ and a molecular weight of 433.53 g/mol. Its IUPAC name is (4E)-3-hydroxy-2-(1-methylindol-3-yl)-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | (4E)-3-hydroxy-2-(1-methylindol-3-yl)-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 136618906 |
| Molecular Formula | C29H25N2O2+ |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (4E)-3-hydroxy-2-(1-methylindol-3-yl)-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | Cn1cc(C2=C(O)/C(=C\C3=[N+](C)c4ccc5ccccc5c4C3(C)C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H24N2O2/c1-29(2)24(31(4)23-14-13-17-9-5-6-10-18(17)26(23)29)15-20-27(32)25(28(20)33)21-16-30(3)22-12-8-7-11-19(21)22/h5-16H,1-4H3/p+1 |
| InChIKey | DLCMGRFKBRWWHH-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|