C30H33N2O3+ — CID 72652288
3-hydroxy-2-[1-(3-methoxybutyl)-2-methylindol-3-yl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 72652288) has the molecular formula C30H33N2O3+ and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-hydroxy-2-[1-(3-methoxybutyl)-2-methylindol-3-yl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | 3-hydroxy-2-[1-(3-methoxybutyl)-2-methylindol-3-yl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 72652288 |
| Molecular Formula | C30H33N2O3+ |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 3-hydroxy-2-[1-(3-methoxybutyl)-2-methylindol-3-yl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | COC(C)CCn1c(C)c(C2=C(O)C(=CC3=[N+](C)c4ccccc4C3(C)C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C30H32N2O3/c1-18(35-6)15-16-32-19(2)26(20-11-7-9-13-23(20)32)27-28(33)21(29(27)34)17-25-30(3,4)22-12-8-10-14-24(22)31(25)5/h7-14,17-18H,15-16H2,1-6H3/p+1 |
| InChIKey | XOJPMRVFOYISRK-UHFFFAOYSA-O |
| XLogP | 5.86 |
| TPSA | 54.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|