C37H33N2O3+ — CID 91219927
2-[3-oxo-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethyl-2H-indol-2-yl)methylidene]cyclobutylidene]indene-1,3-dione (PubChem CID 91219927) has the molecular formula C37H33N2O3+ and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-[3-oxo-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethyl-2H-indol-2-yl)methylidene]cyclobutylidene]indene-1,3-dione.
| Compound Name | 2-[3-oxo-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethyl-2H-indol-2-yl)methylidene]cyclobutylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 91219927 |
| Molecular Formula | C37H33N2O3+ |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 2-[3-oxo-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethyl-2H-indol-2-yl)methylidene]cyclobutylidene]indene-1,3-dione |
| SMILES | CN1c2ccccc2C(C)(C)C1C=C1C(=O)C(=CC2=[N+](C)c3ccccc3C2(C)C)C1=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H33N2O3/c1-36(2)25-15-9-11-17-27(25)38(5)29(36)19-23-31(32-34(41)21-13-7-8-14-22(21)35(32)42)24(33(23)40)20-30-37(3,4)26-16-10-12-18-28(26)39(30)6/h7-20,29H,1-6H3/q+1 |
| InChIKey | ATEUXFLOWYRHNX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|