C30H37N2+ — CID 171372805
1,3,3-trimethyl-2-[5-methyl-7-(1,3,3-trimethyl-2H-indol-2-yl)hepta-1,3,5-trienyl]indol-1-ium (PubChem CID 171372805) has the molecular formula C30H37N2+ and a molecular weight of 425.64 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[5-methyl-7-(1,3,3-trimethyl-2H-indol-2-yl)hepta-1,3,5-trienyl]indol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-[5-methyl-7-(1,3,3-trimethyl-2H-indol-2-yl)hepta-1,3,5-trienyl]indol-1-ium |
|---|---|
| PubChem CID | 171372805 |
| Molecular Formula | C30H37N2+ |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 1,3,3-trimethyl-2-[5-methyl-7-(1,3,3-trimethyl-2H-indol-2-yl)hepta-1,3,5-trienyl]indol-1-ium |
| SMILES | CC(C=CC=CC1=[N+](C)c2ccccc2C1(C)C)=CCC1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C30H37N2/c1-22(20-21-28-30(4,5)24-16-10-12-18-26(24)32(28)7)14-8-13-19-27-29(2,3)23-15-9-11-17-25(23)31(27)6/h8-20,28H,21H2,1-7H3/q+1 |
| InChIKey | ARLGELTYPAVXLW-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|