C35H47N6O+ — CID 171322920
N-(3-azidopropyl)-6-[3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienyl]-2H-indol-1-yl]hexanamide (PubChem CID 171322920) has the molecular formula C35H47N6O+ and a molecular weight of 567.80 g/mol. Its IUPAC name is N-(3-azidopropyl)-6-[3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienyl]-2H-indol-1-yl]hexanamide.
| Compound Name | N-(3-azidopropyl)-6-[3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienyl]-2H-indol-1-yl]hexanamide |
|---|---|
| PubChem CID | 171322920 |
| Molecular Formula | C35H47N6O+ |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.38 |
| IUPAC Name | N-(3-azidopropyl)-6-[3,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienyl]-2H-indol-1-yl]hexanamide |
| SMILES | C[N+]1=C(/C=C/C=C/CC2N(CCCCCC(=O)NCCCN=[N+]=[N-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H46N6O/c1-34(2)27-17-11-13-19-29(27)40(5)31(34)21-8-6-9-22-32-35(3,4)28-18-12-14-20-30(28)41(32)26-15-7-10-23-33(42)37-24-16-25-38-39-36/h6,8-9,11-14,17-21,32H,7,10,15-16,22-26H2,1-5H3/p+1/b9-6+,21-8+ |
| InChIKey | KNSINGRNJAECRQ-ICUOOGJDSA-O |
| XLogP | 7.74 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|