C23H26ClN2+ — CID 59050810
5-chloro-1,3,3-trimethyl-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]indole (PubChem CID 59050810) has the molecular formula C23H26ClN2+ and a molecular weight of 365.93 g/mol. Its IUPAC name is 5-chloro-1,3,3-trimethyl-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]indole.
| Compound Name | 5-chloro-1,3,3-trimethyl-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]indole |
|---|---|
| PubChem CID | 59050810 |
| Molecular Formula | C23H26ClN2+ |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 5-chloro-1,3,3-trimethyl-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]indole |
| SMILES | CN1C(=CC2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H26ClN2/c1-22(2)16-9-7-8-10-18(16)25(5)20(22)14-21-23(3,4)17-13-15(24)11-12-19(17)26(21)6/h7-14H,1-6H3/q+1 |
| InChIKey | WDUYWGYDMBVXAR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|