C33H40ClN3O2+2 — CID 172711377
3-[(2E)-5-chloro-2-[[2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]propyl-trimethylazanium (PubChem CID 172711377) has the molecular formula C33H40ClN3O2+2 and a molecular weight of 546.16 g/mol. Its IUPAC name is 3-[(2E)-5-chloro-2-[[2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]propyl-trimethylazanium.
| Compound Name | 3-[(2E)-5-chloro-2-[[2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 172711377 |
| Molecular Formula | C33H40ClN3O2+2 |
| Molecular Weight | 546.16 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 3-[(2E)-5-chloro-2-[[2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]propyl-trimethylazanium |
| SMILES | C[N+]1=C(C=C2C(=O)C(/C=C3/N(CCC[N+](C)(C)C)c4ccc(Cl)cc4C3(C)C)=C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C33H39ClN3O2/c1-32(2)24-12-9-10-13-26(24)35(5)28(32)19-22-30(38)23(31(22)39)20-29-33(3,4)25-18-21(34)14-15-27(25)36(29)16-11-17-37(6,7)8/h9-10,12-15,18-20H,11,16-17H2,1-8H3/q+1/p+1 |
| InChIKey | WUCDZDVUFLXCAQ-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.16 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|