C31H35N2O2+ — CID 173281077
2-[(1-ethyl-3,3,5-trimethylindol-2-ylidene)methyl]-3-hydroxy-4-[(1,3,3,5-tetramethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 173281077) has the molecular formula C31H35N2O2+ and a molecular weight of 467.63 g/mol. Its IUPAC name is 2-[(1-ethyl-3,3,5-trimethylindol-2-ylidene)methyl]-3-hydroxy-4-[(1,3,3,5-tetramethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | 2-[(1-ethyl-3,3,5-trimethylindol-2-ylidene)methyl]-3-hydroxy-4-[(1,3,3,5-tetramethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 173281077 |
| Molecular Formula | C31H35N2O2+ |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-[(1-ethyl-3,3,5-trimethylindol-2-ylidene)methyl]-3-hydroxy-4-[(1,3,3,5-tetramethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | CCN1C(=CC2=C(O)C(=CC3=[N+](C)c4ccc(C)cc4C3(C)C)C2=O)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C31H34N2O2/c1-9-33-25-13-11-19(3)15-23(25)31(6,7)27(33)17-21-28(34)20(29(21)35)16-26-30(4,5)22-14-18(2)10-12-24(22)32(26)8/h10-17H,9H2,1-8H3/p+1 |
| InChIKey | RKMALCQMCCZGAB-UHFFFAOYSA-O |
| XLogP | 6.33 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|