C32H29N2O2+ — CID 53252304
(4E)-4-[(3,3-dimethyl-1-prop-2-ynylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-prop-2-ynylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 53252304) has the molecular formula C32H29N2O2+ and a molecular weight of 473.60 g/mol. Its IUPAC name is (4E)-4-[(3,3-dimethyl-1-prop-2-ynylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-prop-2-ynylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4E)-4-[(3,3-dimethyl-1-prop-2-ynylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-prop-2-ynylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 53252304 |
| Molecular Formula | C32H29N2O2+ |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4E)-4-[(3,3-dimethyl-1-prop-2-ynylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-prop-2-ynylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | C#CCN1/C(=C/C2=C(O)/C(=C\C3=[N+](CC#C)c4ccccc4C3(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C32H28N2O2/c1-7-17-33-25-15-11-9-13-23(25)31(3,4)27(33)19-21-29(35)22(30(21)36)20-28-32(5,6)24-14-10-12-16-26(24)34(28)18-8-2/h1-2,9-16,19-20H,17-18H2,3-6H3/p+1 |
| InChIKey | UXLFLUXLUPISQB-UHFFFAOYSA-O |
| XLogP | 5.33 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|