C38H33N2O2+ — CID 91869593
(4E)-4-[(3,3-dimethyl-1-phenylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-phenylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 91869593) has the molecular formula C38H33N2O2+ and a molecular weight of 549.69 g/mol. Its IUPAC name is (4E)-4-[(3,3-dimethyl-1-phenylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-phenylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4E)-4-[(3,3-dimethyl-1-phenylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-phenylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 91869593 |
| Molecular Formula | C38H33N2O2+ |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | (4E)-4-[(3,3-dimethyl-1-phenylindol-1-ium-2-yl)methylidene]-2-[(E)-(3,3-dimethyl-1-phenylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CC1(C)C(/C=C2/C(=O)C(/C=C3/N(c4ccccc4)c4ccccc4C3(C)C)=C2O)=[N+](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C38H32N2O2/c1-37(2)29-19-11-13-21-31(29)39(25-15-7-5-8-16-25)33(37)23-27-35(41)28(36(27)42)24-34-38(3,4)30-20-12-14-22-32(30)40(34)26-17-9-6-10-18-26/h5-24H,1-4H3/p+1 |
| InChIKey | QUENUQRXOWRGEH-UHFFFAOYSA-O |
| XLogP | 8.59 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|