C35H33N2+ — CID 91865335
(2Z)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-1-phenylindole (PubChem CID 91865335) has the molecular formula C35H33N2+ and a molecular weight of 481.66 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-1-phenylindole.
| Compound Name | (2Z)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-1-phenylindole |
|---|---|
| PubChem CID | 91865335 |
| Molecular Formula | C35H33N2+ |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (2Z)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethyl-1-phenylindole |
| SMILES | CC1(C)C(/C=C/C=C2\N(c3ccccc3)c3ccccc3C2(C)C)=[N+](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C35H33N2/c1-34(2)28-20-11-13-22-30(28)36(26-16-7-5-8-17-26)32(34)24-15-25-33-35(3,4)29-21-12-14-23-31(29)37(33)27-18-9-6-10-19-27/h5-25H,1-4H3/q+1 |
| InChIKey | JTHJWTFDVVRZQL-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|