C33H31N2+ — CID 90345740
(2E)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-1,1-dimethyl-3H-benzo[e]indole (PubChem CID 90345740) has the molecular formula C33H31N2+ and a molecular weight of 455.63 g/mol. Its IUPAC name is (2E)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-1,1-dimethyl-3H-benzo[e]indole.
| Compound Name | (2E)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-1,1-dimethyl-3H-benzo[e]indole |
|---|---|
| PubChem CID | 90345740 |
| Molecular Formula | C33H31N2+ |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (2E)-2-[(E)-3-(3,3-dimethyl-1-phenylindol-1-ium-2-yl)prop-2-enylidene]-1,1-dimethyl-3H-benzo[e]indole |
| SMILES | CC1(C)C(/C=C/C=C2/Nc3ccc4ccccc4c3C2(C)C)=[N+](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C33H30N2/c1-32(2)26-17-10-11-18-28(26)35(24-14-6-5-7-15-24)30(32)20-12-19-29-33(3,4)31-25-16-9-8-13-23(25)21-22-27(31)34-29/h5-22H,1-4H3/p+1 |
| InChIKey | JIJQSLDFEIHLAS-UHFFFAOYSA-O |
| XLogP | 8.25 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|