C32H31N2+ — CID 59032537
2-[(E,3Z)-3-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 59032537) has the molecular formula C32H31N2+ and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E,3Z)-3-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 59032537 |
| Molecular Formula | C32H31N2+ |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 2-[(E,3Z)-3-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | C[N+]1=C(/C=C/C=C2\Nc3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C32H30N2/c1-31(2)27(33-25-19-17-21-11-6-8-13-23(21)29(25)31)15-10-16-28-32(3,4)30-24-14-9-7-12-22(24)18-20-26(30)34(28)5/h6-20H,1-5H3/p+1 |
| InChIKey | GRYPQNPSSKBYAW-UHFFFAOYSA-O |
| XLogP | 7.84 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|