C25H30N2+2 — CID 156719312
2-[(E,3E)-3-(3,3-dimethyl-1H-indol-1-ium-2-ylidene)prop-1-enyl]-1-ethyl-3,3-dimethylindol-1-ium (PubChem CID 156719312) has the molecular formula C25H30N2+2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 2-[(E,3E)-3-(3,3-dimethyl-1H-indol-1-ium-2-ylidene)prop-1-enyl]-1-ethyl-3,3-dimethylindol-1-ium.
| Compound Name | 2-[(E,3E)-3-(3,3-dimethyl-1H-indol-1-ium-2-ylidene)prop-1-enyl]-1-ethyl-3,3-dimethylindol-1-ium |
|---|---|
| PubChem CID | 156719312 |
| Molecular Formula | C25H30N2+2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[(E,3E)-3-(3,3-dimethyl-1H-indol-1-ium-2-ylidene)prop-1-enyl]-1-ethyl-3,3-dimethylindol-1-ium |
| SMILES | CC[N+]1=C(/C=C/C=C2/[NH2+]c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H28N2/c1-6-27-21-15-10-8-13-19(21)25(4,5)23(27)17-11-16-22-24(2,3)18-12-7-9-14-20(18)26-22/h7-17H,6H2,1-5H3/p+2 |
| InChIKey | ZIGTZKZEECSDLF-UHFFFAOYSA-P |
| XLogP | 4.71 |
| TPSA | 19.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|