C29H30NO+ — CID 146012665
1-ethyl-2-[(E)-2-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-3,3-dimethylindol-1-ium (PubChem CID 146012665) has the molecular formula C29H30NO+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-2-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-3,3-dimethylindol-1-ium.
| Compound Name | 1-ethyl-2-[(E)-2-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-3,3-dimethylindol-1-ium |
|---|---|
| PubChem CID | 146012665 |
| Molecular Formula | C29H30NO+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-ethyl-2-[(E)-2-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]ethenyl]-3,3-dimethylindol-1-ium |
| SMILES | CC[N+]1=C(/C=C/c2ccc(/C=C/c3ccc(OC)cc3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H30NO/c1-5-30-27-9-7-6-8-26(27)29(2,3)28(30)21-18-23-13-10-22(11-14-23)12-15-24-16-19-25(31-4)20-17-24/h6-21H,5H2,1-4H3/q+1/b15-12+,21-18+ |
| InChIKey | UUXXQNANHVCOOP-RJXZOYSOSA-N |
| XLogP | 6.98 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|