C20H23N2O+ — CID 6438043
4-methoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline (PubChem CID 6438043) has the molecular formula C20H23N2O+ and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline.
| Compound Name | 4-methoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 6438043 |
| Molecular Formula | C20H23N2O+ |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-methoxy-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline |
| SMILES | COc1ccc(N/C=C/C2=[N+](C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O/c1-20(2)17-7-5-6-8-18(17)22(3)19(20)13-14-21-15-9-11-16(23-4)12-10-15/h5-14H,1-4H3/p+1 |
| InChIKey | XPPDUTAHXVXVJY-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 24.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|