C27H29N2O2+ — CID 174578494
4-(2,4-dimethoxyphenyl)-N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline (PubChem CID 174578494) has the molecular formula C27H29N2O2+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 174578494 |
| Molecular Formula | C27H29N2O2+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline |
| SMILES | COc1ccc(-c2ccc(NC=CC3=[N+](C)c4ccccc4C3(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H28N2O2/c1-27(2)23-8-6-7-9-24(23)29(3)26(27)16-17-28-20-12-10-19(11-13-20)22-15-14-21(30-4)18-25(22)31-5/h6-18H,1-5H3/p+1 |
| InChIKey | LVIJWUUAMJTACF-UHFFFAOYSA-O |
| XLogP | 6.00 |
| TPSA | 33.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|