C20H24NO2+ — CID 11338459
5-(2,4-dimethoxyphenyl)-1,2,3,3-tetramethylindol-1-ium (PubChem CID 11338459) has the molecular formula C20H24NO2+ and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-1,2,3,3-tetramethylindol-1-ium.
| Compound Name | 5-(2,4-dimethoxyphenyl)-1,2,3,3-tetramethylindol-1-ium |
|---|---|
| PubChem CID | 11338459 |
| Molecular Formula | C20H24NO2+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-1,2,3,3-tetramethylindol-1-ium |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)(C)C(C)=[N+]3C)c(OC)c1 |
| InChI | InChI=1S/C20H24NO2/c1-13-20(2,3)17-11-14(7-10-18(17)21(13)4)16-9-8-15(22-5)12-19(16)23-6/h7-12H,1-6H3/q+1 |
| InChIKey | QOPOMNJVTFWHPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|