C14H13BrO2 — CID 83666366
1-(4-bromophenyl)-2,4-dimethoxybenzene (PubChem CID 83666366) has the molecular formula C14H13BrO2 and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(4-bromophenyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 83666366 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(4-bromophenyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(-c2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C14H13BrO2/c1-16-12-7-8-13(14(9-12)17-2)10-3-5-11(15)6-4-10/h3-9H,1-2H3 |
| InChIKey | UPSXFJZZLOJTQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |