C23H27N2+ — CID 154597393
N-[(1E,3E)-4-[3,3-dimethyl-1-(3-tritiopropyl)indol-1-ium-2-yl]buta-1,3-dienyl]aniline (PubChem CID 154597393) has the molecular formula C23H27N2+ and a molecular weight of 333.49 g/mol. Its IUPAC name is N-[(1E,3E)-4-[3,3-dimethyl-1-(3-tritiopropyl)indol-1-ium-2-yl]buta-1,3-dienyl]aniline.
| Compound Name | N-[(1E,3E)-4-[3,3-dimethyl-1-(3-tritiopropyl)indol-1-ium-2-yl]buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 154597393 |
| Molecular Formula | C23H27N2+ |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-[(1E,3E)-4-[3,3-dimethyl-1-(3-tritiopropyl)indol-1-ium-2-yl]buta-1,3-dienyl]aniline |
| SMILES | [3H]CCC[N+]1=C(/C=C/C=C/Nc2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H26N2/c1-4-18-25-21-15-9-8-14-20(21)23(2,3)22(25)16-10-11-17-24-19-12-6-5-7-13-19/h5-17H,4,18H2,1-3H3/p+1/i1T |
| InChIKey | AAUYLHXDSQFPEX-CNRUNOGKSA-O |
| XLogP | 5.65 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|