C25H25N2O+ — CID 59693526
3,3-dimethyl-1-(2-phenoxyethyl)-2-(2-pyridin-2-ylethenyl)indol-1-ium (PubChem CID 59693526) has the molecular formula C25H25N2O+ and a molecular weight of 369.49 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-phenoxyethyl)-2-(2-pyridin-2-ylethenyl)indol-1-ium.
| Compound Name | 3,3-dimethyl-1-(2-phenoxyethyl)-2-(2-pyridin-2-ylethenyl)indol-1-ium |
|---|---|
| PubChem CID | 59693526 |
| Molecular Formula | C25H25N2O+ |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3,3-dimethyl-1-(2-phenoxyethyl)-2-(2-pyridin-2-ylethenyl)indol-1-ium |
| SMILES | CC1(C)C(C=Cc2ccccn2)=[N+](CCOc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H25N2O/c1-25(2)22-13-6-7-14-23(22)27(18-19-28-21-11-4-3-5-12-21)24(25)16-15-20-10-8-9-17-26-20/h3-17H,18-19H2,1-2H3/q+1 |
| InChIKey | XDOVARRGTHSQCC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 25.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|