C20H24NO2+ — CID 126720628
4-[3-(2,3,3-trimethylindol-1-ium-1-yl)propoxy]phenol (PubChem CID 126720628) has the molecular formula C20H24NO2+ and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[3-(2,3,3-trimethylindol-1-ium-1-yl)propoxy]phenol.
| Compound Name | 4-[3-(2,3,3-trimethylindol-1-ium-1-yl)propoxy]phenol |
|---|---|
| PubChem CID | 126720628 |
| Molecular Formula | C20H24NO2+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-[3-(2,3,3-trimethylindol-1-ium-1-yl)propoxy]phenol |
| SMILES | CC1=[N+](CCCOc2ccc(O)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C20H23NO2/c1-15-20(2,3)18-7-4-5-8-19(18)21(15)13-6-14-23-17-11-9-16(22)10-12-17/h4-5,7-12H,6,13-14H2,1-3H3/p+1 |
| InChIKey | WZLRRTYBGLZDJC-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|