About 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol
4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol (PubChem CID 168782232) has the molecular formula C23H29NO5S
and a molecular weight of 431.55 g/mol. Its IUPAC name is 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol.
Molecular Properties
| Compound Name | 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol |
| PubChem CID | 168782232 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol |
| SMILES | CC1=[N+](CCCOc2ccc(O)cc2)c2ccccc2C1(C)CCCCSOO[O-] |
| InChI | InChI=1S/C23H29NO5S/c1-18-23(2,14-5-6-17-30-29-28-26)21-8-3-4-9-22(21)24(18)15-7-16-27-20-12-10-19(25)11-13-20/h3-4,8-13H,5-7,14-17H2,1-2H3,(H-,25,26) |
| InChIKey | GVWWLZKQSOCFOM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol?
The IUPAC name of 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol (CID 168782232) is 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol.
What is the SMILES notation for 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol?
The canonical SMILES for 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol is CC1=[N+](CCCOc2ccc(O)cc2)c2ccccc2C1(C)CCCCSOO[O-].
What is the InChIKey of 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol?
The InChIKey is GVWWLZKQSOCFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO5S/c1-18-23(2,14-5-6-17-30-29-28-26)21-8-3-4-9-22(21)24(18)15-7-16-27-20-12-10-19(25)11-13-20/h3-4,8-13H,5-7,14-17H2,1-2H3,(H-,25,26).
What are the key properties of 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol?
4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol has a molecular weight of 431.55 g/mol, XLogP of 4.28, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2,3-dimethyl-3-(4-oxidoperoxysulfanylbutyl)indol-1-ium-1-yl]propoxy]phenol is sourced from PubChem (CID 168782232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).