C21H29NO3 — CID 145279726
methanol;4-[3-(2,3,3-trimethyl-2H-indol-1-yl)propoxy]phenol (PubChem CID 145279726) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is methanol;4-[3-(2,3,3-trimethyl-2H-indol-1-yl)propoxy]phenol.
| Compound Name | methanol;4-[3-(2,3,3-trimethyl-2H-indol-1-yl)propoxy]phenol |
|---|---|
| PubChem CID | 145279726 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | methanol;4-[3-(2,3,3-trimethyl-2H-indol-1-yl)propoxy]phenol |
| SMILES | CC1N(CCCOc2ccc(O)cc2)c2ccccc2C1(C)C.CO |
| InChI | InChI=1S/C20H25NO2.CH4O/c1-15-20(2,3)18-7-4-5-8-19(18)21(15)13-6-14-23-17-11-9-16(22)10-12-17;1-2/h4-5,7-12,15,22H,6,13-14H2,1-3H3;2H,1H3 |
| InChIKey | MAUFQHMGOCJRDO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|