C13H19NO6PS+ — CID 158692995
sulfur trioxide;2-(2,3,3-trimethylindol-1-ium-1-yl)ethylphosphonic acid (PubChem CID 158692995) has the molecular formula C13H19NO6PS+ and a molecular weight of 348.34 g/mol. Its IUPAC name is sulfur trioxide;2-(2,3,3-trimethylindol-1-ium-1-yl)ethylphosphonic acid.
| Compound Name | sulfur trioxide;2-(2,3,3-trimethylindol-1-ium-1-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 158692995 |
| Molecular Formula | C13H19NO6PS+ |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | sulfur trioxide;2-(2,3,3-trimethylindol-1-ium-1-yl)ethylphosphonic acid |
| SMILES | CC1=[N+](CCP(=O)(O)O)c2ccccc2C1(C)C.O=S(=O)=O |
| InChI | InChI=1S/C13H18NO3P.O3S/c1-10-13(2,3)11-6-4-5-7-12(11)14(10)8-9-18(15,16)17;1-4(2)3/h4-7H,8-9H2,1-3H3,(H-,15,16,17);/p+1 |
| InChIKey | IGOXENZRZVPNBI-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|