C16H24NO+ — CID 20650907
5-(2,3,3-trimethylindol-1-ium-1-yl)pentan-1-ol (PubChem CID 20650907) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is 5-(2,3,3-trimethylindol-1-ium-1-yl)pentan-1-ol.
| Compound Name | 5-(2,3,3-trimethylindol-1-ium-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 20650907 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 5-(2,3,3-trimethylindol-1-ium-1-yl)pentan-1-ol |
| SMILES | CC1=[N+](CCCCCO)c2ccccc2C1(C)C |
| InChI | InChI=1S/C16H24NO/c1-13-16(2,3)14-9-5-6-10-15(14)17(13)11-7-4-8-12-18/h5-6,9-10,18H,4,7-8,11-12H2,1-3H3/q+1 |
| InChIKey | IZSFNCDUULFDGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|