C20H26NO+ — CID 20650910
5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentan-1-ol (PubChem CID 20650910) has the molecular formula C20H26NO+ and a molecular weight of 296.43 g/mol. Its IUPAC name is 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentan-1-ol.
| Compound Name | 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentan-1-ol |
|---|---|
| PubChem CID | 20650910 |
| Molecular Formula | C20H26NO+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentan-1-ol |
| SMILES | CC1=[N+](CCCCCO)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C20H26NO/c1-15-20(2,3)19-17-10-6-5-9-16(17)11-12-18(19)21(15)13-7-4-8-14-22/h5-6,9-12,22H,4,7-8,13-14H2,1-3H3/q+1 |
| InChIKey | DMORESWINJPVDL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|