C21H28N+ — CID 23558525
3-hexyl-1,1,2-trimethylbenzo[e]indol-3-ium (PubChem CID 23558525) has the molecular formula C21H28N+ and a molecular weight of 294.46 g/mol. Its IUPAC name is 3-hexyl-1,1,2-trimethylbenzo[e]indol-3-ium.
| Compound Name | 3-hexyl-1,1,2-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 23558525 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3-hexyl-1,1,2-trimethylbenzo[e]indol-3-ium |
| SMILES | CCCCCC[N+]1=C(C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C21H28N/c1-5-6-7-10-15-22-16(2)21(3,4)20-18-12-9-8-11-17(18)13-14-19(20)22/h8-9,11-14H,5-7,10,15H2,1-4H3/q+1 |
| InChIKey | IISIBZGYARZGSA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|