C23H32N+ — CID 11385361
1,1,2-trimethyl-3-octylbenzo[e]indol-3-ium (PubChem CID 11385361) has the molecular formula C23H32N+ and a molecular weight of 322.52 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-octylbenzo[e]indol-3-ium.
| Compound Name | 1,1,2-trimethyl-3-octylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 11385361 |
| Molecular Formula | C23H32N+ |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1,1,2-trimethyl-3-octylbenzo[e]indol-3-ium |
| SMILES | CCCCCCCC[N+]1=C(C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C23H32N/c1-5-6-7-8-9-12-17-24-18(2)23(3,4)22-20-14-11-10-13-19(20)15-16-21(22)24/h10-11,13-16H,5-9,12,17H2,1-4H3/q+1 |
| InChIKey | PYKUTOFIXIZUQH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|