C21H26NO2+ — CID 10862345
6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid (PubChem CID 10862345) has the molecular formula C21H26NO2+ and a molecular weight of 324.44 g/mol. Its IUPAC name is 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid.
| Compound Name | 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 10862345 |
| Molecular Formula | C21H26NO2+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 6-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)hexanoic acid |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C21H25NO2/c1-15-21(2,3)20-17-10-7-6-9-16(17)12-13-18(20)22(15)14-8-4-5-11-19(23)24/h6-7,9-10,12-13H,4-5,8,11,14H2,1-3H3/p+1 |
| InChIKey | PPPYIABAZASBHI-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|