C18H22NOS+ — CID 18343753
1,1,2-trimethyl-3-(3-sulfanyloxypropyl)benzo[e]indol-3-ium (PubChem CID 18343753) has the molecular formula C18H22NOS+ and a molecular weight of 300.45 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(3-sulfanyloxypropyl)benzo[e]indol-3-ium.
| Compound Name | 1,1,2-trimethyl-3-(3-sulfanyloxypropyl)benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 18343753 |
| Molecular Formula | C18H22NOS+ |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1,1,2-trimethyl-3-(3-sulfanyloxypropyl)benzo[e]indol-3-ium |
| SMILES | CC1=[N+](CCCOS)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C18H21NOS/c1-13-18(2,3)17-15-8-5-4-7-14(15)9-10-16(17)19(13)11-6-12-20-21/h4-5,7-10H,6,11-12H2,1-3H3/p+1 |
| InChIKey | MBKINSXVRMGNDK-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 12.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|