C22H28NO2+ — CID 170215624
3-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]-1,1,2-trimethylbenzo[e]indol-3-ium (PubChem CID 170215624) has the molecular formula C22H28NO2+ and a molecular weight of 338.47 g/mol. Its IUPAC name is 3-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]-1,1,2-trimethylbenzo[e]indol-3-ium.
| Compound Name | 3-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]-1,1,2-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 170215624 |
| Molecular Formula | C22H28NO2+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-[2-(1,3-dioxolan-2-yl)-2-methylpropyl]-1,1,2-trimethylbenzo[e]indol-3-ium |
| SMILES | CC1=[N+](CC(C)(C)C2OCCO2)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C22H28NO2/c1-15-22(4,5)19-17-9-7-6-8-16(17)10-11-18(19)23(15)14-21(2,3)20-24-12-13-25-20/h6-11,20H,12-14H2,1-5H3/q+1 |
| InChIKey | OLVMPMUXLBJPCM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|