C31H33N2O3S+ — CID 157452495
sulfur trioxide;1,1,2,3-tetramethylbenzo[e]indol-3-ium;1,1,2-trimethylbenzo[e]indole (PubChem CID 157452495) has the molecular formula C31H33N2O3S+ and a molecular weight of 513.68 g/mol. Its IUPAC name is sulfur trioxide;1,1,2,3-tetramethylbenzo[e]indol-3-ium;1,1,2-trimethylbenzo[e]indole.
| Compound Name | sulfur trioxide;1,1,2,3-tetramethylbenzo[e]indol-3-ium;1,1,2-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 157452495 |
| Molecular Formula | C31H33N2O3S+ |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | sulfur trioxide;1,1,2,3-tetramethylbenzo[e]indol-3-ium;1,1,2-trimethylbenzo[e]indole |
| SMILES | CC1=Nc2ccc3ccccc3c2C1(C)C.CC1=[N+](C)c2ccc3ccccc3c2C1(C)C.O=S(=O)=O |
| InChI | InChI=1S/C16H18N.C15H15N.O3S/c1-11-16(2,3)15-13-8-6-5-7-12(13)9-10-14(15)17(11)4;1-10-15(2,3)14-12-7-5-4-6-11(12)8-9-13(14)16-10;1-4(2)3/h5-10H,1-4H3;4-9H,1-3H3;/q+1;; |
| InChIKey | BSYQUNMXDBYPEZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|