1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride

C15H14ClNO2 — CID 69037883

IUPAC1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride
SMILESCC1(C)C(C(=O)O)=Nc2ccc3ccccc3c21.Cl
InChIInChI=1S/C15H13NO2.ClH/c1-15(2)12-10-6-4-3-5-9(10)7-8-11(12)16-13(15)14(17)18;/h3-8H,1-2H3,(H,17,18);1H
InChIKeyQRFCHIUPYQQSQH-UHFFFAOYSA-N
MW275.74 g/mol
LogP3.71
Rot. Bonds1

About 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride

1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride (PubChem CID 69037883) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride.

Molecular Properties

Compound Name1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride
PubChem CID69037883
Molecular FormulaC15H14ClNO2
Molecular Weight275.74 g/mol
Exact Mass275.07
IUPAC Name1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride
SMILESCC1(C)C(C(=O)O)=Nc2ccc3ccccc3c21.Cl
InChIInChI=1S/C15H13NO2.ClH/c1-15(2)12-10-6-4-3-5-9(10)7-8-11(12)16-13(15)14(17)18;/h3-8H,1-2H3,(H,17,18);1H
InChIKeyQRFCHIUPYQQSQH-UHFFFAOYSA-N
XLogP3.71
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.74
LogP ≤ 53.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride?
The IUPAC name of 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride (CID 69037883) is 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride?
The canonical SMILES for 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride is CC1(C)C(C(=O)O)=Nc2ccc3ccccc3c21.Cl.
What is the InChIKey of 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride?
The InChIKey is QRFCHIUPYQQSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2.ClH/c1-15(2)12-10-6-4-3-5-9(10)7-8-11(12)16-13(15)14(17)18;/h3-8H,1-2H3,(H,17,18);1H.
What are the key properties of 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride?
1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride has a molecular weight of 275.74 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 69037883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).