C15H14ClNO2 — CID 69037883
1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride (PubChem CID 69037883) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride.
| Compound Name | 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 69037883 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1,1-dimethylbenzo[e]indole-2-carboxylic acid;hydrochloride |
| SMILES | CC1(C)C(C(=O)O)=Nc2ccc3ccccc3c21.Cl |
| InChI | InChI=1S/C15H13NO2.ClH/c1-15(2)12-10-6-4-3-5-9(10)7-8-11(12)16-13(15)14(17)18;/h3-8H,1-2H3,(H,17,18);1H |
| InChIKey | QRFCHIUPYQQSQH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |