C35H28N2O3 — CID 70797729
3-[(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)methyl]-5-[(1,1-dimethylbenzo[e]indol-2-yl)methylidene]-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 70797729) has the molecular formula C35H28N2O3 and a molecular weight of 524.62 g/mol. Its IUPAC name is 3-[(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)methyl]-5-[(1,1-dimethylbenzo[e]indol-2-yl)methylidene]-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | 3-[(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)methyl]-5-[(1,1-dimethylbenzo[e]indol-2-yl)methylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 70797729 |
| Molecular Formula | C35H28N2O3 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-[(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)methyl]-5-[(1,1-dimethylbenzo[e]indol-2-yl)methylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | CC1(C)C(C=C2C(=O)C(=O)C(C=C3Nc4ccc5ccccc5c4C3(C)C)=C2O)=Nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C35H28N2O3/c1-34(2)27(36-25-15-13-19-9-5-7-11-21(19)29(25)34)17-23-31(38)24(33(40)32(23)39)18-28-35(3,4)30-22-12-8-6-10-20(22)14-16-26(30)37-28/h5-18,36,38H,1-4H3 |
| InChIKey | QFBVVLSGJVMGMX-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|